| Nome del prodotto |
1,3-Diethoxybenzene |
| Sinonimi |
1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
| Formula molecolare |
C10H14O2 |
| Peso Molecolare |
166.217 |
| InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
| Numero CAS |
2049-73-2 |
| EINECS |
218-071-3 |
| Struttura molecolare |
|
| Densità |
0.975g/cm3 |
| Punto di fusione |
10-236℃ |
| Punto di ebollizione |
238.5°C at 760 mmHg |
| Indice di rifrazione |
1.485 |
| Punto d'infiammabilità |
87.1°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
