| Nome del prodotto |
2-Chloropyridine-N-Oxide |
| Sinonimi |
2-Chloropyridine N-oxide; 2-chloro-3-fluoropyridine 1-oxide |
| Formula molecolare |
C5H3ClFNO |
| Peso Molecolare |
147.5348 |
| InChI |
InChI=1/C5H3ClFNO/c6-5-4(7)2-1-3-8(5)9/h1-3H |
| Numero CAS |
2402-95-1 |
| EINECS |
219-284-4 |
| Struttura molecolare |
|
| Densità |
1.41g/cm3 |
| Punto di ebollizione |
317.1°C at 760 mmHg |
| Indice di rifrazione |
1.53 |
| Punto d'infiammabilità |
145.6°C |
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
