| Nome del prodotto |
4-methyl-2-phenyl-2-pentenal |
| Sinonimi |
Benzeneacetaldehyde, alpha-(2-methylpropylidene)-; 2-Pentenal, 4-methyl-2-phenyl-; 4-Methyl-2-phenyl-2-pentenal; 4-Methyl-2-phenyl-2-penteral; 4-Methyl-2-phenyl-2-penteral (natural); FEMA No. 3200; alpha-(2-Methylpropylidene)benzeneacetaldehyde; alpha-Isobutylidenebenzeneacetaldehyde; 4-methyl-2-phenylpent-2-enal; (2Z)-4-methyl-2-phenylpent-2-enal; (2E)-4-methyl-2-phenylpent-2-enal |
| Formula molecolare |
C12H14O |
| Peso Molecolare |
174.239 |
| InChI |
InChI=1/C12H14O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8- |
| Numero CAS |
26643-91-4 |
| EINECS |
247-869-4 |
| Struttura molecolare |
|
| Densità |
0.962g/cm3 |
| Punto di ebollizione |
295.1°C at 760 mmHg |
| Indice di rifrazione |
1.517 |
| Punto d'infiammabilità |
113.9°C |
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
