Nome del prodotto |
4-Fluoro-1-iodo-2-nitrobenzene |
Sinonimi |
2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
Formula molecolare |
C6H5FN2O2 |
Peso Molecolare |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
Numero CAS |
364-77-2 |
EINECS |
206-666-0 |
Struttura molecolare |
|
Densità |
1.448g/cm3 |
Punto di ebollizione |
295.1°C at 760 mmHg |
Indice di rifrazione |
1.603 |
Punto d'infiammabilità |
89.4°C |
Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|