Nome del prodotto |
N,N-Dimethyl-3-nitroaniline |
Sinonimi |
3-Nitro-N,N-dimethylaniline; Benzenamine, N,N-dimethyl-3-nitro- |
Formula molecolare |
C8H10N2O2 |
Peso Molecolare |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-9(2)7-4-3-5-8(6-7)10(11)12/h3-6H,1-2H3 |
Numero CAS |
619-31-8 |
EINECS |
210-590-3 |
Struttura molecolare |
|
Densità |
1.193g/cm3 |
Punto di fusione |
57-61℃ |
Punto di ebollizione |
282.5°C at 760 mmHg |
Indice di rifrazione |
1.591 |
Punto d'infiammabilità |
117°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|