Nome del prodotto |
5-Bromo-§ |
Sinonimi |
5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
Formula molecolare |
C7H5BrO4 |
Peso Molecolare |
233.0162 |
InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
Numero CAS |
7355-22-8 |
EINECS |
230-881-9 |
Struttura molecolare |
|
Densità |
2.026g/cm3 |
Punto di ebollizione |
436.7°C at 760 mmHg |
Indice di rifrazione |
1.703 |
Punto d'infiammabilità |
217.9°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|