| 상품명칭 |
3-Chlorodiphenylamine |
| 별명 |
Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| 분자식 |
C12H10ClN |
| 분자량 |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| cas번호 |
101-17-7 |
| EC번호 |
202-922-0 |
| 분자 구조 |
|
| 밀도 |
1.216g/cm3 |
| 비등점 |
337.8°C at 760 mmHg |
| 굴절 지수 |
1.642 |
| 인화점 |
147.4°C |
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
