상품명칭 |
2-Hydroxythioanisole |
별명 |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
분자식 |
C7H8OS |
분자량 |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
cas번호 |
1073-29-6 |
EC번호 |
214-027-2 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
비등점 |
206.1°C at 760 mmHg |
굴절 지수 |
1.613 |
인화점 |
108°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|