상품명칭 |
2-bromo-4-hydroxymethylpyridine |
별명 |
2-Bromo-4-(hydroxymethyl)pyridine; 2-Bromopyridine-4-methanol; (2-bromopyridin-4-yl)methanol |
분자식 |
C6H6BrNO |
분자량 |
188.0219 |
InChI |
InChI=1/C6H6BrNO/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2 |
cas번호 |
118289-16-0 |
분자 구조 |
|
밀도 |
1.668g/cm3 |
비등점 |
316.6°C at 760 mmHg |
굴절 지수 |
1.598 |
인화점 |
145.3°C |
위험성 표시 |
Xi:;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|