상품명칭 |
1,3-Dihydroxynaphthalene |
별명 |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
분자식 |
C10H8O2 |
분자량 |
160.1693 |
InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
cas번호 |
132-86-5 |
EC번호 |
205-079-7 |
분자 구조 |
|
밀도 |
1.33g/cm3 |
녹는 점 |
123-126℃ |
비등점 |
361.5°C at 760 mmHg |
굴절 지수 |
1.725 |
인화점 |
185.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|