상품명칭 |
N-Ethyldiethanolamine |
별명 |
2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
분자식 |
C6H16NO2 |
분자량 |
134.1962 |
InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
cas번호 |
139-87-7 |
EC번호 |
205-379-8 |
분자 구조 |
|
녹는 점 |
-50℃ |
비등점 |
246.4°C at 760 mmHg |
인화점 |
123.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|