상품명칭 |
2-sec-butylcyclohexanone |
별명 |
Cyclohexanone, 2-(1-methylpropyl)-; 2-(1-Methylpropyl)cyclohexanone; 2-sec-Butylcyclohexanone; BRN 1859137; Butylcyclohexanone, O-sec-; Cyclohexanone, 2-sec-butyl-; FEMA No. 3261; NSC 21146; UNII-5WA6R1KL5J; 2-sec-Butylcyclohexan-1-one; Cyclohexanone, 2-sec-butyl-; 2-(butan-2-yl)cyclohexanone; 2-(1-Methylpropyl)-Cyclohexanone |
분자식 |
C10H18O |
분자량 |
154.2493 |
InChI |
InChI=1/C10H18O/c1-3-8(2)9-6-4-5-7-10(9)11/h8-9H,3-7H2,1-2H3 |
cas번호 |
14765-30-1 |
EC번호 |
238-830-2 |
분자 구조 |
|
밀도 |
0.899g/cm3 |
비등점 |
213.5°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
75.8°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|