상품명칭 |
2-Chloro-6-fluorobenzylamine |
별명 |
1-(2-chloro-6-fluorophenyl)methanamine; (2-chloro-6-fluorophenyl)methanaminium; (2-Chloro-6-fluorophenyl)methanamine; 2-Chloro-6-fluorobenzyl amine |
분자식 |
C7H8ClFN |
분자량 |
160.596 |
InChI |
InChI=1/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2/p+1 |
cas번호 |
15205-15-9 |
EC번호 |
239-259-1 |
분자 구조 |
|
비등점 |
211.1°C at 760 mmHg |
인화점 |
81.5°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|