상품명칭 |
(2-bromo-3-thienyl)methylamine |
별명 |
1-(2-bromothiophen-3-yl)methanamine; 1-(2-bromothiophen-3-yl)methanamine hydrochloride; 2-bromo-3-thiophenemethylamine;
|
분자식 |
C5H7BrClNS |
분자량 |
228.5378 |
InChI |
InChI=1/C5H6BrNS.ClH/c6-5-4(3-7)1-2-8-5;/h1-2H,3,7H2;1H |
cas번호 |
157664-47-6 |
분자 구조 |
|
비등점 |
244.7°C at 760 mmHg |
인화점 |
101.8°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|