상품명칭 |
2,4-Bis(chloromethyl)mesitylene |
별명 |
2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene; 2,4-Di(chloromethyl)-1,3,5-trimethylbenzene; 2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
분자식 |
C11H14Cl2 |
분자량 |
217.1349 |
InChI |
InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
cas번호 |
1585-17-7 |
분자 구조 |
|
밀도 |
1.121g/cm3 |
녹는 점 |
104-105℃ |
비등점 |
311.7°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
154.9°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|