상품명칭 |
p-butylphenol |
별명 |
4-n-Butylphenol; 4-butylphenol |
분자식 |
C10H14O |
분자량 |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
cas번호 |
1638-22-8 |
EC번호 |
216-672-5 |
분자 구조 |
|
밀도 |
0.977g/cm3 |
비등점 |
246.2°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
121.5°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|