상품명칭 |
4-Chloro-3-nitro-2-pyridone |
별명 |
4-Chloro-2-hydroxy-3-nitropyridine; 4-chloro-3-nitropyridin-2(1H)-one; 4-Chloro-3-Nitropyridin-2-Ol |
분자식 |
C5H3ClN2O3 |
분자량 |
174.5419 |
InChI |
InChI=1/C5H3ClN2O3/c6-3-1-2-7-5(9)4(3)8(10)11/h1-2H,(H,7,9) |
cas번호 |
165547-79-5 |
분자 구조 |
|
밀도 |
1.61g/cm3 |
비등점 |
283.4°C at 760 mmHg |
굴절 지수 |
1.602 |
인화점 |
125.2°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|