상품명칭 |
1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one |
별명 |
3-[2-Oxo-3-(trifluoromethyl)-1,2-dihydropyridin-1-yl]propanenitrile; 1-(2-Cyanoethyl)-3-(trifluoromethyl)-2(1H)-pyridone; [(2,4-difluorophenyl)sulfanyl]acetonitrile |
분자식 |
C8H5F2NS |
분자량 |
185.1938 |
InChI |
InChI=1/C8H5F2NS/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
cas번호 |
175277-60-8 |
분자 구조 |
|
밀도 |
1.31g/cm3 |
녹는 점 |
88-89℃ |
비등점 |
242.4°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
100.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|