| 상품명칭 |
6-Methylpyridazin-3-amine |
| 별명 |
3-Amino-6-Methylpyridazine |
| 분자식 |
C5H7N3 |
| 분자량 |
109.13068 |
| InChI |
InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
| cas번호 |
18591-82-7 |
| EC번호 |
242-430-3 |
| 분자 구조 |
|
| 밀도 |
2.204g/cm3 |
| 녹는 점 |
230℃ |
| 비등점 |
399.6°C at 760 mmHg |
| 굴절 지수 |
1.719 |
| 인화점 |
195.5°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
