상품명칭 |
4-Chloro-3,5-dinitrobenzonitrile |
별명 |
Benzonitrile, 4-chloro-3,5-dinitro-; 4-Chloro-3,5-dinitrobenzenenitrile; AI3-28718; BRN 1990451; NSC 74453 |
분자식 |
C7H2ClN3O4 |
분자량 |
227.5615 |
InChI |
InChI=1/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H |
cas번호 |
1930-72-9 |
EC번호 |
217-686-4 |
분자 구조 |
|
밀도 |
1.68g/cm3 |
녹는 점 |
137-143℃ |
비등점 |
326.3°C at 760 mmHg |
굴절 지수 |
1.631 |
인화점 |
151.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|