상품명칭 |
1,2,7,8-Diepoxyoctane |
별명 |
Octadienediepoxide; 1,7-Octadiene diepoxide; 1,2,7,8-Dipoxyoctane, >97%; 2,2'-butane-1,4-diyldioxirane; (2R,2'S)-2,2'-butane-1,4-diyldioxirane; (2S,2'S)-2,2'-butane-1,4-diyldioxirane |
분자식 |
C8H14O2 |
분자량 |
142.1956 |
InChI |
InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
cas번호 |
2426-07-5 |
EC번호 |
219-375-9 |
분자 구조 |
|
밀도 |
1.051g/cm3 |
비등점 |
240°C at 760 mmHg |
굴절 지수 |
1.477 |
인화점 |
97.8°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R24:Toxic in contact with skin.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|