| 상품명칭 |
3,5-diiodosalicylaldehyde |
| 별명 |
3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde; 2-hydroxy-3,5-diiodobenzaldehyde |
| 분자식 |
C7H4I2O2 |
| 분자량 |
373.9144 |
| InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H |
| cas번호 |
2631-77-8 |
| EC번호 |
220-117-2 |
| 분자 구조 |
|
| 밀도 |
2.602g/cm3 |
| 녹는 점 |
109-110℃ |
| 비등점 |
304.6°C at 760 mmHg |
| 굴절 지수 |
1.787 |
| 인화점 |
138°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
