상품명칭 |
2,5-Dichlorophenylhydrazine |
별명 |
-2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
분자식 |
C6H6Cl2N2 |
분자량 |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
cas번호 |
305-15-7 |
EC번호 |
206-163-6 |
분자 구조 |
|
밀도 |
1.475g/cm3 |
녹는 점 |
100-104℃ |
비등점 |
266.8°C at 760 mmHg |
굴절 지수 |
1.665 |
인화점 |
115.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|