상품명칭 |
Cyclohexylphenylacetonitrile |
별명 |
alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
분자식 |
C14H17N |
분자량 |
199.2915 |
InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
cas번호 |
3893-23-0 |
EC번호 |
223-442-8 |
분자 구조 |
|
밀도 |
1.019g/cm3 |
녹는 점 |
49-55℃ |
비등점 |
322.5°C at 760 mmHg |
굴절 지수 |
1.54 |
인화점 |
156.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|