상품명칭 |
2,4-difluorophenylhydrazine |
별명 |
1-(2,4-Difluorophenyl)hydrazine; (2,4-difluorophenyl)hydrazine hydrochloride |
분자식 |
C6H7ClF2N2 |
분자량 |
180.583 |
InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
cas번호 |
40594-30-7 |
분자 구조 |
|
녹는 점 |
65-67℃ |
비등점 |
185.1°C at 760 mmHg |
인화점 |
65.7°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|