상품명칭 |
1-Benzylhomopiperazine |
별명 |
1-Benzylhexahydro-1,4-diazepine; N-benzylhomopiperazine; 1-benzyl-1,4-diazepane; 1-Benzyl-1,4-diazacycloheptane; 1-Benzyl-1,4-diazacycloheptanel |
분자식 |
C12H18N2 |
분자량 |
190.2847 |
InChI |
InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
cas번호 |
4410-12-2 |
분자 구조 |
|
밀도 |
1.003g/cm3 |
비등점 |
286.5°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
116.2°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|