| 상품명칭 |
Primuletin |
| 별명 |
5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| 분자식 |
C15H10O3 |
| 분자량 |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| cas번호 |
491-78-1 |
| EC번호 |
207-743-1 |
| 분자 구조 |
|
| 밀도 |
1.34g/cm3 |
| 비등점 |
425°C at 760 mmHg |
| 굴절 지수 |
1.666 |
| 인화점 |
165.4°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
