| 상품명칭 |
4-Piperazinoacetophenone |
| 별명 |
piperazin-4-ylacetophenone; 1-[4-(piperazin-1-yl)phenyl]ethanone; 1-phenyl-2-piperazin-1-ylethanone; 4-(4-acetylphenyl)piperazin-1-ium; 4'-poperazinoacetophenone; 4'-Piperazinoacetophenone |
| 분자식 |
C12H17N2O |
| 분자량 |
205.2756 |
| InChI |
InChI=1/C12H16N2O/c1-10(15)11-2-4-12(5-3-11)14-8-6-13-7-9-14/h2-5,13H,6-9H2,1H3/p+1 |
| cas번호 |
51639-48-6 |
| EC번호 |
257-332-6 |
| 분자 구조 |
|
| 녹는 점 |
107-112℃ |
| 비등점 |
382.4°C at 760 mmHg |
| 인화점 |
185.1°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
