상품명칭 |
2,3,4,5-Tetrafluorophenylacetonitrile |
별명 |
2,3,4,5-Tetrafluorobenzyl cyanide |
분자식 |
C8H3F4N |
분자량 |
189.1097 |
InChI |
InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2 |
cas번호 |
53001-74-4 |
분자 구조 |
|
밀도 |
1.427g/cm3 |
비등점 |
208.5°C at 760 mmHg |
굴절 지수 |
1.451 |
인화점 |
103.9°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|