상품명칭 |
1,2-Dimethylcyclohexane |
별명 |
1,2-Dimethylcyclohexane (cis+trans); (1R,2R)-1,2-dimethylcyclohexane |
분자식 |
C8H16 |
분자량 |
112.2126 |
InChI |
InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
cas번호 |
583-57-3 |
EC번호 |
209-509-4 |
분자 구조 |
|
밀도 |
0.766g/cm3 |
비등점 |
125.9°C at 760 mmHg |
굴절 지수 |
1.42 |
인화점 |
15.6°C |
위험성 표시 |
F:Highly flammable;
|
리스크 규칙 |
R11:Highly flammable.;
R38:Irritating to skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|