상품명칭 |
benzene-1,3-dithiol |
별명 |
1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
분자식 |
C6H6S2 |
분자량 |
142.2418 |
InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
cas번호 |
626-04-0 |
EC번호 |
210-925-3 |
분자 구조 |
|
밀도 |
1.24g/cm3 |
녹는 점 |
24-25℃ |
비등점 |
244.3°C at 760 mmHg |
굴절 지수 |
1.665 |
인화점 |
112.7°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|