상품명칭 |
NN-Dipropylformamide |
별명 |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
분자식 |
C7H15NO |
분자량 |
129.2001 |
InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
cas번호 |
6282-00-4 |
분자 구조 |
|
밀도 |
0.869g/cm3 |
비등점 |
221.3°C at 760 mmHg |
굴절 지수 |
1.429 |
인화점 |
83.7°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|