상품명칭 |
4-(N-Nitrosomethylamino)-1-(3-pyridyl)-1-butanone |
별명 |
NNK; 4-(N-Methyl-N-nitrosamino)-1-(3-pyridyl)-1-butanone; 4-[methyl(nitroso)amino]-1-(pyridin-3-yl)butan-1-one; 4-[methyl(nitroso)amino]-4-(pyridin-3-yl)butanal; 4-[(nitrosomethyl)amino]-1-(pyridin-3-yl)butan-1-one |
분자식 |
C10H13N3O2 |
분자량 |
207.2291 |
InChI |
InChI=1/C10H13N3O2/c14-10(4-2-6-12-8-13-15)9-3-1-5-11-7-9/h1,3,5,7,12H,2,4,6,8H2 |
cas번호 |
64091-91-4 |
분자 구조 |
|
밀도 |
1.192g/cm3 |
비등점 |
361.605°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
172.493°C |
리스크 규칙 |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|