| 상품명칭 |
4-Fluorophthalonitrile |
| 별명 |
4-Fluorophthalodinitrile; 1,2-Dicyano-4-Fluorobenzene; 4-Fluorobenzene-1,2-Dicarbonitrile; 4-fluoro-1,2-benzenedicarbonitrile; 4-fluoro-2-benzenedicarbonitrile; 1,2-Benzenedicarbonitrile,4-fluoro-; 4-Fluorobenzene-1,2-dicarbonitrile; 4-Fluorobenzene-1,2-dinitrile |
| 분자식 |
C8H3FN2 |
| 분자량 |
146.1212 |
| InChI |
InChI=1/C8H3FN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
| cas번호 |
65610-14-2 |
| 분자 구조 |
|
| 밀도 |
1.27g/cm3 |
| 녹는 점 |
100-102℃ |
| 비등점 |
303.7°C at 760 mmHg |
| 굴절 지수 |
1.538 |
| 인화점 |
137.5°C |
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
