| 상품명칭 |
3-Amino-6-chloro-4-picoline |
| 별명 |
2-CHLORO-4-METHYL-5-AMINOPYRIDINE; 6-chloro-4-methylpyridin-3-amine; 5-Amino-2-chloro-4-methylpyridine; 5-amino-2-chloro-4-picoline |
| 분자식 |
C6H7ClN2 |
| 분자량 |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
| cas번호 |
66909-38-4 |
| 분자 구조 |
|
| 밀도 |
1.26g/cm3 |
| 비등점 |
309.7°C at 760 mmHg |
| 굴절 지수 |
1.592 |
| 인화점 |
141.1°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
