| 상품명칭 |
7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| 별명 |
7-(chloromethyl)-3,4-dihydro-2H-benzo[b][1,4]dioxepine |
| 분자식 |
C10H11ClO2 |
| 분자량 |
198.6461 |
| InChI |
InChI=1/C10H11ClO2/c11-7-8-2-3-9-10(6-8)13-5-1-4-12-9/h2-3,6H,1,4-5,7H2 |
| cas번호 |
67869-70-9 |
| 분자 구조 |
|
| 밀도 |
1.213g/cm3 |
| 비등점 |
296.429°C at 760 mmHg |
| 굴절 지수 |
1.54 |
| 인화점 |
123.16°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
