| Naam product |
3-Chlorodiphenylamine |
| Synoniemen |
Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| MF |
C12H10ClN |
| Molecuulgewicht |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| CAS-nummer |
101-17-7 |
| EINECS |
202-922-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.216g/cm3 |
| Kookpunt |
337.8°C at 760 mmHg |
| Brekingsindex |
1.642 |
| Vlampunt |
147.4°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
