Naam product |
6-ethoxy-2-mercaptobenzothiazole |
Synoniemen |
6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
MF |
C9H9NOS2 |
Molecuulgewicht |
211.3039 |
InChI |
InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
CAS-nummer |
120-53-6 |
EINECS |
204-405-5 |
Moleculaire Structuur |
|
Dichtheid |
1.37g/cm3 |
Smeltpunt |
198-200℃ |
Kookpunt |
358.5°C at 760 mmHg |
Brekingsindex |
1.698 |
Vlampunt |
170.6°C |
Risico-codes |
R36/37:Irritating to eyes and respiratory system.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|