Naam product |
4-Bromo-2,3,5,6-tetrafluorobenzoylchloride |
Synoniemen |
4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride |
MF |
C7BrClF4O |
Molecuulgewicht |
291.4249 |
InChI |
InChI=1/C7BrClF4O/c8-2-5(12)3(10)1(7(9)14)4(11)6(2)13 |
CAS-nummer |
122033-54-9 |
Moleculaire Structuur |
|
Dichtheid |
1.957g/cm3 |
Kookpunt |
216.5°C at 760 mmHg |
Brekingsindex |
1.505 |
Vlampunt |
84.8°C |
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|