Naam product |
2-(5-bromo-2-thienyl)pyridine |
Synoniemen |
2-(5-bromothiophen-2-yl)pyridine |
MF |
C9H6BrNS |
Molecuulgewicht |
240.1196 |
InChI |
InChI=1/C9H6BrNS/c10-9-5-4-8(12-9)7-3-1-2-6-11-7/h1-6H |
CAS-nummer |
123784-07-6 |
Moleculaire Structuur |
|
Dichtheid |
1.563g/cm3 |
Smeltpunt |
86℃ |
Kookpunt |
301.7°C at 760 mmHg |
Brekingsindex |
1.635 |
Vlampunt |
136.2°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|