Naam product |
beta-Bromoisopropylbenzene |
Synoniemen |
1-Bromo-2-phenylpropane; beta-Bromocumene; 2-Phenylpropyl bromide; [(2S)-1-bromopropan-2-yl]benzene; β-Bromoisopropylbenzene |
MF |
C9H11Br |
Molecuulgewicht |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/t8-/m1/s1 |
CAS-nummer |
1459-00-3 |
EINECS |
215-948-2 |
Moleculaire Structuur |
|
Dichtheid |
1.303g/cm3 |
Kookpunt |
188.5°C at 760 mmHg |
Brekingsindex |
1.543 |
Vlampunt |
85.9°C |
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|