| Naam product |
5-(2,3-Dichlorophenyl)-1H-tetrazole |
| Synoniemen |
5-(2,3-Dichlorophenyl)tetrazole; 5-(2,3-dichlorophenyl)-2H-tetrazole |
| MF |
C7H4Cl2N4 |
| Molecuulgewicht |
215.0395 |
| InChI |
InChI=1/C7H4Cl2N4/c8-5-3-1-2-4(6(5)9)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| CAS-nummer |
175205-12-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.574g/cm3 |
| Kookpunt |
408.3°C at 760 mmHg |
| Brekingsindex |
1.641 |
| Vlampunt |
233.1°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
