Naam product |
2-Bromo-1-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-ethanone |
Synoniemen |
2-bromo-1-(2,3-dihydrobenzo[b][1,4]dioxin-5-yl)ethanone; 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-5-yl)ethanone |
MF |
C10H9BrO3 |
Molecuulgewicht |
257.0807 |
InChI |
InChI=1/C10H9BrO3/c11-6-8(12)7-2-1-3-9-10(7)14-5-4-13-9/h1-3H,4-6H2 |
CAS-nummer |
19815-97-5 |
Moleculaire Structuur |
|
Dichtheid |
1.577g/cm3 |
Smeltpunt |
99℃ |
Kookpunt |
348.076°C at 760 mmHg |
Brekingsindex |
1.587 |
Vlampunt |
164.311°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|