Naam product |
5-Chloro-2-mercaptobenzimidazole |
Synoniemen |
5-Chlorobenzimidazole-2-thiol; 6-chloro-1H-benzimidazole-2-thiol |
MF |
C7H5ClN2S |
Molecuulgewicht |
184.646 |
InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
CAS-nummer |
25369-78-2 |
EINECS |
246-903-5 |
Moleculaire Structuur |
|
Dichtheid |
1.54g/cm3 |
Smeltpunt |
290-292℃ |
Kookpunt |
300.7°C at 760 mmHg |
Brekingsindex |
1.75 |
Vlampunt |
135.6°C |
Gevaarsymbolen |
T:Toxic;
|
Risico-codes |
R25:Toxic if swallowed.;
|
Veiligheid Omschrijving |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|