Naam product |
2-Bromopyridine-4-carboxamide |
Synoniemen |
2-Bromoisonicotinamide |
MF |
C6H5BrN2O |
Molecuulgewicht |
201.0207 |
InChI |
InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
CAS-nummer |
29840-73-1 |
Moleculaire Structuur |
|
Dichtheid |
1.71g/cm3 |
Kookpunt |
338.1°C at 760 mmHg |
Brekingsindex |
1.613 |
Vlampunt |
158.3°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|