Naam product |
4-Nitro-1-Naphthol |
Synoniemen |
4-nitronaphthalen-1-ol |
MF |
C10H7NO3 |
Molecuulgewicht |
189.1675 |
InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
CAS-nummer |
605-62-9 |
Moleculaire Structuur |
|
Dichtheid |
1.413g/cm3 |
Kookpunt |
398.8°C at 760 mmHg |
Brekingsindex |
1.714 |
Vlampunt |
179.8°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|