Naam product |
2-Nitrobenzamide |
Synoniemen |
Benzamide, o-nitro-; 2-Carbamoylnitrobenzene; 4-09-00-01049 (Beilstein Handbook Reference); BRN 1950928; NSC 407995; o-Nitrobenzamide; Benzamide, 2-nitro-; Benzamide, 2-nitro- (9CI) |
MF |
C7H6N2O3 |
Molecuulgewicht |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H,(H2,8,10) |
CAS-nummer |
610-15-1 |
EINECS |
210-208-5 |
Moleculaire Structuur |
|
Dichtheid |
1.385g/cm3 |
Smeltpunt |
174-178℃ |
Kookpunt |
317.864°C at 760 mmHg |
Brekingsindex |
1.612 |
Vlampunt |
146.039°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|