Naam product |
Fluoroacetamide |
Synoniemen |
1081; 2-Fluoroacetamide; 4-02-00-00454 (Beilstein Handbook Reference); AFL 1081; AI3-25667; Amid kyseliny fluoroctove; Amid kyseliny fluoroctove [Czech]; BRN 1739054; Baran; Caswell No. 461; Compound 1081; EPA Pesticide Chemical Code 075002; FAA; Fluorakil 100; Fluorkill; Fluoroacetic acid amide; Fluoroakil 100; Flutritex 1; Fussol; HSDB 2880; Megatox; Monofluoroacetamide; NSC 31876; Navron; RCRA waste number P057; Yanock; Acetamide, 2-fluoro-; RCRA waste no. P057 |
MF |
C2H4FNO |
Molecuulgewicht |
77.0577 |
InChI |
InChI=1/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) |
CAS-nummer |
640-19-7 |
EINECS |
211-363-1 |
Moleculaire Structuur |
|
Dichtheid |
1.136g/cm3 |
Smeltpunt |
106-109℃ |
Kookpunt |
259°C at 760 mmHg |
Brekingsindex |
1.362 |
Vlampunt |
110.4°C |
Gevaarsymbolen |
T+:Very toxic;
|
Risico-codes |
R24:Toxic in contact with skin.;
R28:Very toxic if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|