| Naam product |
2-n-Propylphenol |
| Synoniemen |
2-Propylphenol; 1-(2-Hydroxyphenyl)propane; 1-Hydroxy-2-n-propylbenzene; 4-06-00-03176 (Beilstein Handbook Reference); BRN 1363932; FEMA No. 3522; NSC 65646; Phenol, 2-propyl-; Phenol, o-propyl-; o-Propylphenol |
| MF |
C9H12O |
| Molecuulgewicht |
136.191 |
| InChI |
InChI=1/C9H12O/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7,10H,2,5H2,1H3 |
| CAS-nummer |
644-35-9 |
| EINECS |
211-415-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.992g/cm3 |
| Kookpunt |
220°C at 760 mmHg |
| Brekingsindex |
1.529 |
| Vlampunt |
93.3°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
