Naam product |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde |
Synoniemen |
2,2-Difluoro-5-formyl-1,3-benzodioxole; 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde; 2,2-Difluorobenzodioxole-5-Carboxaldehyde; 2,2-Difluoro-5-formylbenzodioxole;
|
MF |
C8H4F2O3 |
Molecuulgewicht |
186.1124 |
InChI |
InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H |
CAS-nummer |
656-42-8 |
Moleculaire Structuur |
|
Dichtheid |
1.5g/cm3 |
Kookpunt |
210.5°C at 760 mmHg |
Brekingsindex |
1.525 |
Vlampunt |
79.1°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|